C17H22N2O2 — CID 100803716
prop-2-ynyl 5-(methylamino)-2-[(2R)-2-methylpiperidin-1-yl]benzoate (PubChem CID 100803716) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is prop-2-ynyl 5-(methylamino)-2-[(2R)-2-methylpiperidin-1-yl]benzoate.
| Compound Name | prop-2-ynyl 5-(methylamino)-2-[(2R)-2-methylpiperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 100803716 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | prop-2-ynyl 5-(methylamino)-2-[(2R)-2-methylpiperidin-1-yl]benzoate |
| SMILES | C#CCOC(=O)c1cc(NC)ccc1N1CCCC[C@H]1C |
| InChI | InChI=1S/C17H22N2O2/c1-4-11-21-17(20)15-12-14(18-3)8-9-16(15)19-10-6-5-7-13(19)2/h1,8-9,12-13,18H,5-7,10-11H2,2-3H3/t13-/m1/s1 |
| InChIKey | WRNYRBATVCYZFX-CYBMUJFWSA-N |
| XLogP | 2.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|