C18H22N2O4 — CID 100804554
[5-(3-amino-4-methoxyphenyl)furan-2-yl]-[(2S,6S)-2,6-dimethylmorpholin-4-yl]methanone (PubChem CID 100804554) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is [5-(3-amino-4-methoxyphenyl)furan-2-yl]-[(2S,6S)-2,6-dimethylmorpholin-4-yl]methanone.
| Compound Name | [5-(3-amino-4-methoxyphenyl)furan-2-yl]-[(2S,6S)-2,6-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 100804554 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | [5-(3-amino-4-methoxyphenyl)furan-2-yl]-[(2S,6S)-2,6-dimethylmorpholin-4-yl]methanone |
| SMILES | COc1ccc(-c2ccc(C(=O)N3C[C@H](C)O[C@@H](C)C3)o2)cc1N |
| InChI | InChI=1S/C18H22N2O4/c1-11-9-20(10-12(2)23-11)18(21)17-7-6-15(24-17)13-4-5-16(22-3)14(19)8-13/h4-8,11-12H,9-10,19H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | MDFQVJMHRWCNSD-RYUDHWBXSA-N |
| XLogP | 2.79 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|