C18H21ClN2O2 — CID 100804658
[5-(5-amino-2-chlorophenyl)furan-2-yl]-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanone (PubChem CID 100804658) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is [5-(5-amino-2-chlorophenyl)furan-2-yl]-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanone.
| Compound Name | [5-(5-amino-2-chlorophenyl)furan-2-yl]-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 100804658 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [5-(5-amino-2-chlorophenyl)furan-2-yl]-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanone |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=O)c1ccc(-c2cc(N)ccc2Cl)o1 |
| InChI | InChI=1S/C18H21ClN2O2/c1-11-4-3-5-12(2)21(11)18(22)17-9-8-16(23-17)14-10-13(20)6-7-15(14)19/h6-12H,3-5,20H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | OBWPYYLEBHENHC-RYUDHWBXSA-N |
| XLogP | 4.59 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|