About (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine
(2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine (PubChem CID 100804935) has the molecular formula C13H16BrClN2O2
and a molecular weight of 347.64 g/mol. Its IUPAC name is (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine.
Molecular Properties
| Compound Name | (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine |
| PubChem CID | 100804935 |
| Molecular Formula | C13H16BrClN2O2 |
| Molecular Weight | 347.64 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine |
| SMILES | C[C@@H]1CCC[C@H](C)N1c1c(Cl)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C13H16BrClN2O2/c1-8-4-3-5-9(2)16(8)13-11(14)6-10(17(18)19)7-12(13)15/h6-9H,3-5H2,1-2H3/t8-,9+ |
| InChIKey | CUPSDOGDPQWKAO-DTORHVGOSA-N |
| XLogP | 4.78 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine?
The IUPAC name of (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine (CID 100804935) is (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine.
What is the SMILES notation for (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine?
The canonical SMILES for (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine is C[C@@H]1CCC[C@H](C)N1c1c(Cl)cc([N+](=O)[O-])cc1Br.
What is the InChIKey of (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine?
The InChIKey is CUPSDOGDPQWKAO-DTORHVGOSA-N. The full InChI is InChI=1S/C13H16BrClN2O2/c1-8-4-3-5-9(2)16(8)13-11(14)6-10(17(18)19)7-12(13)15/h6-9H,3-5H2,1-2H3/t8-,9+.
What are the key properties of (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine?
(2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine has a molecular weight of 347.64 g/mol, XLogP of 4.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-1-(2-bromo-6-chloro-4-nitrophenyl)-2,6-dimethylpiperidine is sourced from PubChem (CID 100804935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).