C19H20N2O6S — CID 100804998
methyl (3R)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 100804998) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is methyl (3R)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (3R)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 100804998 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | methyl (3R)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(=O)N(c2ccc(S(=O)(=O)Nc3ccc(OC)cc3)cc2)C1 |
| InChI | InChI=1S/C19H20N2O6S/c1-26-16-7-3-14(4-8-16)20-28(24,25)17-9-5-15(6-10-17)21-12-13(11-18(21)22)19(23)27-2/h3-10,13,20H,11-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | AUPSSGXPJJDOFW-CYBMUJFWSA-N |
| XLogP | 2.02 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |