About [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate
[(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate (PubChem CID 100806456) has the molecular formula C24H23ClO5
and a molecular weight of 426.90 g/mol. Its IUPAC name is [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate.
Molecular Properties
| Compound Name | [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate |
| PubChem CID | 100806456 |
| Molecular Formula | C24H23ClO5 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate |
| SMILES | COc1cc(-c2cc3ccccc3oc2=O)c(Cl)cc1C(=O)O[C@H]1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C24H23ClO5/c1-14-6-5-8-16(10-14)29-24(27)19-12-20(25)17(13-22(19)28-2)18-11-15-7-3-4-9-21(15)30-23(18)26/h3-4,7,9,11-14,16H,5-6,8,10H2,1-2H3/t14-,16+/m1/s1 |
| InChIKey | DONFBPZWLZLMAR-ZBFHGGJFSA-N |
| XLogP | 5.86 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate?
The IUPAC name of [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate (CID 100806456) is [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate.
What is the SMILES notation for [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate?
The canonical SMILES for [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate is COc1cc(-c2cc3ccccc3oc2=O)c(Cl)cc1C(=O)O[C@H]1CCC[C@@H](C)C1.
What is the InChIKey of [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate?
The InChIKey is DONFBPZWLZLMAR-ZBFHGGJFSA-N. The full InChI is InChI=1S/C24H23ClO5/c1-14-6-5-8-16(10-14)29-24(27)19-12-20(25)17(13-22(19)28-2)18-11-15-7-3-4-9-21(15)30-23(18)26/h3-4,7,9,11-14,16H,5-6,8,10H2,1-2H3/t14-,16+/m1/s1.
What are the key properties of [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate?
[(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate has a molecular weight of 426.90 g/mol, XLogP of 5.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3R)-3-methylcyclohexyl] 5-chloro-2-methoxy-4-(2-oxochromen-3-yl)benzoate is sourced from PubChem (CID 100806456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).