C20H17NO9 — CID 100806762
4-[(3aR,4R,7R,7aS)-7-(diacetyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]benzoic acid (PubChem CID 100806762) has the molecular formula C20H17NO9 and a molecular weight of 415.35 g/mol. Its IUPAC name is 4-[(3aR,4R,7R,7aS)-7-(diacetyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]benzoic acid.
| Compound Name | 4-[(3aR,4R,7R,7aS)-7-(diacetyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 100806762 |
| Molecular Formula | C20H17NO9 |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 4-[(3aR,4R,7R,7aS)-7-(diacetyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]benzoic acid |
| SMILES | CC(=O)OC(OC(C)=O)[C@]12C=C[C@@H](O1)[C@@H]1C(=O)N(c3ccc(C(=O)O)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C20H17NO9/c1-9(22)28-19(29-10(2)23)20-8-7-13(30-20)14-15(20)17(25)21(16(14)24)12-5-3-11(4-6-12)18(26)27/h3-8,13-15,19H,1-2H3,(H,26,27)/t13-,14+,15-,20-/m1/s1 |
| InChIKey | NSGPVAGSGZFMBW-IGMJJTELSA-N |
| XLogP | 0.65 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|