C13H14BrN5O2 — CID 1008073
1-[(4-bromo-1-methylpyrazole-3-carbonyl)amino]-3-(3-methylphenyl)urea (PubChem CID 1008073) has the molecular formula C13H14BrN5O2 and a molecular weight of 352.19 g/mol. Its IUPAC name is 1-[(4-bromo-1-methylpyrazole-3-carbonyl)amino]-3-(3-methylphenyl)urea.
| Compound Name | 1-[(4-bromo-1-methylpyrazole-3-carbonyl)amino]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 1008073 |
| Molecular Formula | C13H14BrN5O2 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 1-[(4-bromo-1-methylpyrazole-3-carbonyl)amino]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NNC(=O)c2nn(C)cc2Br)c1 |
| InChI | InChI=1S/C13H14BrN5O2/c1-8-4-3-5-9(6-8)15-13(21)17-16-12(20)11-10(14)7-19(2)18-11/h3-7H,1-2H3,(H,16,20)(H2,15,17,21) |
| InChIKey | BYTQBRVGEIBZDR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|