C20H21BrN2O2 — CID 100807539
(1R,2R,6S,7R,8S,10R)-4-[(4-bromo-3,5-dimethylanilino)methyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 100807539) has the molecular formula C20H21BrN2O2 and a molecular weight of 401.30 g/mol. Its IUPAC name is (1R,2R,6S,7R,8S,10R)-4-[(4-bromo-3,5-dimethylanilino)methyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R,8S,10R)-4-[(4-bromo-3,5-dimethylanilino)methyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 100807539 |
| Molecular Formula | C20H21BrN2O2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | (1R,2R,6S,7R,8S,10R)-4-[(4-bromo-3,5-dimethylanilino)methyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | Cc1cc(NCN2C(=O)[C@@H]3[C@@H]4C=C[C@H]([C@H]5C[C@@H]45)[C@@H]3C2=O)cc(C)c1Br |
| InChI | InChI=1S/C20H21BrN2O2/c1-9-5-11(6-10(2)18(9)21)22-8-23-19(24)16-12-3-4-13(15-7-14(12)15)17(16)20(23)25/h3-6,12-17,22H,7-8H2,1-2H3/t12-,13-,14-,15+,16+,17-/m1/s1 |
| InChIKey | ADAGSCDZPVUSQZ-ZBURPKILSA-N |
| XLogP | 3.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|