C38H32FNO3P2 — CID 100809141
(1S,2R,6R,7S,8S,9R)-8,9-bis(diphenylphosphoryl)-5-(4-fluorophenyl)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene (PubChem CID 100809141) has the molecular formula C38H32FNO3P2 and a molecular weight of 631.62 g/mol. Its IUPAC name is (1S,2R,6R,7S,8S,9R)-8,9-bis(diphenylphosphoryl)-5-(4-fluorophenyl)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene.
| Compound Name | (1S,2R,6R,7S,8S,9R)-8,9-bis(diphenylphosphoryl)-5-(4-fluorophenyl)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene |
|---|---|
| PubChem CID | 100809141 |
| Molecular Formula | C38H32FNO3P2 |
| Molecular Weight | 631.62 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | (1S,2R,6R,7S,8S,9R)-8,9-bis(diphenylphosphoryl)-5-(4-fluorophenyl)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@@H]1[C@H]2C[C@@H]([C@@H]3C(c4ccc(F)cc4)=NO[C@@H]23)[C@@H]1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H32FNO3P2/c39-27-23-21-26(22-24-27)35-34-32-25-33(36(34)43-40-35)38(45(42,30-17-9-3-10-18-30)31-19-11-4-12-20-31)37(32)44(41,28-13-5-1-6-14-28)29-15-7-2-8-16-29/h1-24,32-34,36-38H,25H2/t32-,33-,34+,36-,37-,38+/m0/s1 |
| InChIKey | MWNYMQJXYBAJDE-PJKYWEIRSA-N |
| XLogP | 6.96 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|