C11H16O2 — CID 10081007
(1'S,6'S,8'R)-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] (PubChem CID 10081007) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1'S,6'S,8'R)-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene].
| Compound Name | (1'S,6'S,8'R)-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] |
|---|---|
| PubChem CID | 10081007 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1'S,6'S,8'R)-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] |
| SMILES | C[C@@H]1[C@@H]2C=CCC[C@@H]2C12OCCO2 |
| InChI | InChI=1S/C11H16O2/c1-8-9-4-2-3-5-10(9)11(8)12-6-7-13-11/h2,4,8-10H,3,5-7H2,1H3/t8-,9+,10+/m1/s1 |
| InChIKey | AKHNEQGJSIELGA-UTLUCORTSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|