About (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol
(1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol (PubChem CID 10081136) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol.
Molecular Properties
| Compound Name | (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol |
| PubChem CID | 10081136 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol |
| SMILES | CC(C)(C)NC[C@H](O)C1CC=NO1 |
| InChI | InChI=1S/C9H18N2O2/c1-9(2,3)10-6-7(12)8-4-5-11-13-8/h5,7-8,10,12H,4,6H2,1-3H3/t7-,8?/m0/s1 |
| InChIKey | ZKFPUXIOTDWDAE-JAMMHHFISA-N |
| XLogP | 0.51 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol?
The IUPAC name of (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol (CID 10081136) is (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol.
What is the SMILES notation for (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol?
The canonical SMILES for (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol is CC(C)(C)NC[C@H](O)C1CC=NO1.
What is the InChIKey of (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol?
The InChIKey is ZKFPUXIOTDWDAE-JAMMHHFISA-N. The full InChI is InChI=1S/C9H18N2O2/c1-9(2,3)10-6-7(12)8-4-5-11-13-8/h5,7-8,10,12H,4,6H2,1-3H3/t7-,8?/m0/s1.
What are the key properties of (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol?
(1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol has a molecular weight of 186.25 g/mol, XLogP of 0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-(tert-butylamino)-1-(4,5-dihydro-1,2-oxazol-5-yl)ethanol is sourced from PubChem (CID 10081136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).