About 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one
3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one (PubChem CID 10081295) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one |
| PubChem CID | 10081295 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one |
| SMILES | CN[C@H](C)C/C=C/c1c[nH]ccc1=O |
| InChI | InChI=1S/C11H16N2O/c1-9(12-2)4-3-5-10-8-13-7-6-11(10)14/h3,5-9,12H,4H2,1-2H3,(H,13,14)/b5-3+/t9-/m1/s1 |
| InChIKey | YNSYDGJJBRDOGI-HYYFJVDXSA-N |
| XLogP | 1.39 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one?
The IUPAC name of 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one (CID 10081295) is 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one.
What is the SMILES notation for 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one?
The canonical SMILES for 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one is CN[C@H](C)C/C=C/c1c[nH]ccc1=O.
What is the InChIKey of 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one?
The InChIKey is YNSYDGJJBRDOGI-HYYFJVDXSA-N. The full InChI is InChI=1S/C11H16N2O/c1-9(12-2)4-3-5-10-8-13-7-6-11(10)14/h3,5-9,12H,4H2,1-2H3,(H,13,14)/b5-3+/t9-/m1/s1.
What are the key properties of 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one?
3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one has a molecular weight of 192.26 g/mol, XLogP of 1.39, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E,4R)-4-(methylamino)pent-1-enyl]-1H-pyridin-4-one is sourced from PubChem (CID 10081295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).