About N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine
N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine (PubChem CID 10081379) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine |
| PubChem CID | 10081379 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine |
| SMILES | Cc1cc(C2OCCO2)ncc1NO |
| InChI | InChI=1S/C9H12N2O3/c1-6-4-7(9-13-2-3-14-9)10-5-8(6)11-12/h4-5,9,11-12H,2-3H2,1H3 |
| InChIKey | IRSJZEROAOTONP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine?
The IUPAC name of N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine (CID 10081379) is N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine.
What is the SMILES notation for N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine?
The canonical SMILES for N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine is Cc1cc(C2OCCO2)ncc1NO.
What is the InChIKey of N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine?
The InChIKey is IRSJZEROAOTONP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-6-4-7(9-13-2-3-14-9)10-5-8(6)11-12/h4-5,9,11-12H,2-3H2,1H3.
What are the key properties of N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine?
N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine has a molecular weight of 196.21 g/mol, XLogP of 1.24, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(1,3-dioxolan-2-yl)-4-methyl-3-pyridinyl]hydroxylamine is sourced from PubChem (CID 10081379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).