About trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane
trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane (PubChem CID 10081462) has the molecular formula C10H18O2Si
and a molecular weight of 198.34 g/mol. Its IUPAC name is trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane.
Molecular Properties
| Compound Name | trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane |
| PubChem CID | 10081462 |
| Molecular Formula | C10H18O2Si |
| Molecular Weight | 198.34 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane |
| SMILES | C[Si](C)(C)OC1=C[C@H]2CC[C@@H](C1)O2 |
| InChI | InChI=1S/C10H18O2Si/c1-13(2,3)12-10-6-8-4-5-9(7-10)11-8/h6,8-9H,4-5,7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | LDDSYOHYZHNABX-BDAKNGLRSA-N |
| XLogP | 2.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane?
The IUPAC name of trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane (CID 10081462) is trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane.
What is the SMILES notation for trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane?
The canonical SMILES for trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane is C[Si](C)(C)OC1=C[C@H]2CC[C@@H](C1)O2.
What is the InChIKey of trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane?
The InChIKey is LDDSYOHYZHNABX-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H18O2Si/c1-13(2,3)12-10-6-8-4-5-9(7-10)11-8/h6,8-9H,4-5,7H2,1-3H3/t8-,9+/m1/s1.
What are the key properties of trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane?
trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane has a molecular weight of 198.34 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-2-en-3-yl]oxy]silane is sourced from PubChem (CID 10081462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).