About (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione
(8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione (PubChem CID 10081493) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione.
Molecular Properties
| Compound Name | (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione |
| PubChem CID | 10081493 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione |
| SMILES | C[C@@H]1C[C@H](O)CCCC(=O)CC(=O)O1 |
| InChI | InChI=1S/C10H16O4/c1-7-5-8(11)3-2-4-9(12)6-10(13)14-7/h7-8,11H,2-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | CFFWJDRYTUTBMI-HTQZYQBOSA-N |
| XLogP | 0.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione?
The IUPAC name of (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione (CID 10081493) is (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione.
What is the SMILES notation for (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione?
The canonical SMILES for (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione is C[C@@H]1C[C@H](O)CCCC(=O)CC(=O)O1.
What is the InChIKey of (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione?
The InChIKey is CFFWJDRYTUTBMI-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H16O4/c1-7-5-8(11)3-2-4-9(12)6-10(13)14-7/h7-8,11H,2-6H2,1H3/t7-,8-/m1/s1.
What are the key properties of (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione?
(8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione has a molecular weight of 200.23 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8R,10R)-8-hydroxy-10-methyloxecane-2,4-dione is sourced from PubChem (CID 10081493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).