C18H20N2O3 — CID 100815207
N-(4-hydroxycyclohexyl)-6-oxo-1-phenylpyridine-3-carboxamide (PubChem CID 100815207) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-6-oxo-1-phenylpyridine-3-carboxamide.
| Compound Name | N-(4-hydroxycyclohexyl)-6-oxo-1-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 100815207 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-6-oxo-1-phenylpyridine-3-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)c1ccc(=O)n(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O3/c21-16-9-7-14(8-10-16)19-18(23)13-6-11-17(22)20(12-13)15-4-2-1-3-5-15/h1-6,11-12,14,16,21H,7-10H2,(H,19,23) |
| InChIKey | HYVAOQAVOUSURE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |