About (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide
(5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide (PubChem CID 100815803) has the molecular formula C12H11N3O2S2
and a molecular weight of 293.37 g/mol. Its IUPAC name is (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide |
| PubChem CID | 100815803 |
| Molecular Formula | C12H11N3O2S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide |
| SMILES | C[C@@]1(C(=O)Nc2nccs2)CC(c2cccs2)=NO1 |
| InChI | InChI=1S/C12H11N3O2S2/c1-12(10(16)14-11-13-4-6-19-11)7-8(15-17-12)9-3-2-5-18-9/h2-6H,7H2,1H3,(H,13,14,16)/t12-/m0/s1 |
| InChIKey | YSRULULFZZAGTJ-LBPRGKRZSA-N |
| XLogP | 2.73 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide?
The IUPAC name of (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide (CID 100815803) is (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide.
What is the SMILES notation for (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide?
The canonical SMILES for (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide is C[C@@]1(C(=O)Nc2nccs2)CC(c2cccs2)=NO1.
What is the InChIKey of (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide?
The InChIKey is YSRULULFZZAGTJ-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H11N3O2S2/c1-12(10(16)14-11-13-4-6-19-11)7-8(15-17-12)9-3-2-5-18-9/h2-6H,7H2,1H3,(H,13,14,16)/t12-/m0/s1.
What are the key properties of (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide?
(5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide has a molecular weight of 293.37 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methyl-N-(1,3-thiazol-2-yl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 100815803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).