About 5,7-dimethoxyquinolin-3-ol
5,7-dimethoxyquinolin-3-ol (PubChem CID 10081664) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is 5,7-dimethoxyquinolin-3-ol.
Molecular Properties
| Compound Name | 5,7-dimethoxyquinolin-3-ol |
| PubChem CID | 10081664 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 5,7-dimethoxyquinolin-3-ol |
| SMILES | COc1cc(OC)c2cc(O)cnc2c1 |
| InChI | InChI=1S/C11H11NO3/c1-14-8-4-10-9(11(5-8)15-2)3-7(13)6-12-10/h3-6,13H,1-2H3 |
| InChIKey | NIKWFBSURWACKL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dimethoxyquinolin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethoxyquinolin-3-ol?
The IUPAC name of 5,7-dimethoxyquinolin-3-ol (CID 10081664) is 5,7-dimethoxyquinolin-3-ol.
What is the SMILES notation for 5,7-dimethoxyquinolin-3-ol?
The canonical SMILES for 5,7-dimethoxyquinolin-3-ol is COc1cc(OC)c2cc(O)cnc2c1.
What is the InChIKey of 5,7-dimethoxyquinolin-3-ol?
The InChIKey is NIKWFBSURWACKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-14-8-4-10-9(11(5-8)15-2)3-7(13)6-12-10/h3-6,13H,1-2H3.
What are the key properties of 5,7-dimethoxyquinolin-3-ol?
5,7-dimethoxyquinolin-3-ol has a molecular weight of 205.21 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethoxyquinolin-3-ol is sourced from PubChem (CID 10081664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).