About 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione
5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione (PubChem CID 10081667) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione.
Molecular Properties
| Compound Name | 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione |
| PubChem CID | 10081667 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione |
| SMILES | CN(C)c1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C10H11N3O2/c1-13(2)7-5-3-4-6-8(7)10(15)12-11-9(6)14/h3-5H,1-2H3,(H,11,14)(H,12,15) |
| InChIKey | VADOZAQQRPYARO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione?
The IUPAC name of 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione (CID 10081667) is 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione.
What is the SMILES notation for 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione?
The canonical SMILES for 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione is CN(C)c1cccc2c(=O)[nH][nH]c(=O)c12.
What is the InChIKey of 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione?
The InChIKey is VADOZAQQRPYARO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-13(2)7-5-3-4-6-8(7)10(15)12-11-9(6)14/h3-5H,1-2H3,(H,11,14)(H,12,15).
What are the key properties of 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione?
5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione has a molecular weight of 205.22 g/mol, XLogP of 0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-2,3-dihydrophthalazine-1,4-dione is sourced from PubChem (CID 10081667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).