About 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one
3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one (PubChem CID 100816750) has the molecular formula C23H27N3O
and a molecular weight of 361.49 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one.
Molecular Properties
| Compound Name | 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one |
| PubChem CID | 100816750 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one |
| SMILES | Cc1ccc(/N=C2\C(=O)N(CN3CCC[C@H](C)C3)c3ccccc32)cc1C |
| InChI | InChI=1S/C23H27N3O/c1-16-7-6-12-25(14-16)15-26-21-9-5-4-8-20(21)22(23(26)27)24-19-11-10-17(2)18(3)13-19/h4-5,8-11,13,16H,6-7,12,14-15H2,1-3H3/b24-22-/t16-/m0/s1 |
| InChIKey | SWIJQIWLIYQYSS-DYYXWGBJSA-N |
| XLogP | 4.46 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one?
The IUPAC name of 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one (CID 100816750) is 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one.
What is the SMILES notation for 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one?
The canonical SMILES for 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one is Cc1ccc(/N=C2\C(=O)N(CN3CCC[C@H](C)C3)c3ccccc32)cc1C.
What is the InChIKey of 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one?
The InChIKey is SWIJQIWLIYQYSS-DYYXWGBJSA-N. The full InChI is InChI=1S/C23H27N3O/c1-16-7-6-12-25(14-16)15-26-21-9-5-4-8-20(21)22(23(26)27)24-19-11-10-17(2)18(3)13-19/h4-5,8-11,13,16H,6-7,12,14-15H2,1-3H3/b24-22-/t16-/m0/s1.
What are the key properties of 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one?
3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one has a molecular weight of 361.49 g/mol, XLogP of 4.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylphenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one is sourced from PubChem (CID 100816750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).