About 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine
1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine (PubChem CID 10081695) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine |
| PubChem CID | 10081695 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine |
| SMILES | CC1(C)CCCC=C1/C=C/N1CCCC1 |
| InChI | InChI=1S/C14H23N/c1-14(2)9-4-3-7-13(14)8-12-15-10-5-6-11-15/h7-8,12H,3-6,9-11H2,1-2H3/b12-8+ |
| InChIKey | SJKYGWRQVFBLGM-XYOKQWHBSA-N |
| XLogP | 3.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine?
The IUPAC name of 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine (CID 10081695) is 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine.
What is the SMILES notation for 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine?
The canonical SMILES for 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine is CC1(C)CCCC=C1/C=C/N1CCCC1.
What is the InChIKey of 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine?
The InChIKey is SJKYGWRQVFBLGM-XYOKQWHBSA-N. The full InChI is InChI=1S/C14H23N/c1-14(2)9-4-3-7-13(14)8-12-15-10-5-6-11-15/h7-8,12H,3-6,9-11H2,1-2H3/b12-8+.
What are the key properties of 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine?
1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine has a molecular weight of 205.34 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-2-(6,6-dimethylcyclohexen-1-yl)ethenyl]pyrrolidine is sourced from PubChem (CID 10081695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).