About 1-bromo-2,4-difluoro-5-methylbenzene
1-bromo-2,4-difluoro-5-methylbenzene (PubChem CID 10081748) has the molecular formula C7H5BrF2
and a molecular weight of 207.02 g/mol. Its IUPAC name is 1-bromo-2,4-difluoro-5-methylbenzene.
Molecular Properties
| Compound Name | 1-bromo-2,4-difluoro-5-methylbenzene |
| PubChem CID | 10081748 |
| Molecular Formula | C7H5BrF2 |
| Molecular Weight | 207.02 g/mol |
| Exact Mass | 205.95 |
| IUPAC Name | 1-bromo-2,4-difluoro-5-methylbenzene |
| SMILES | Cc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C7H5BrF2/c1-4-2-5(8)7(10)3-6(4)9/h2-3H,1H3 |
| InChIKey | WOCZKGUFVNUBEC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.02 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,4-difluoro-5-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,4-difluoro-5-methylbenzene?
The IUPAC name of 1-bromo-2,4-difluoro-5-methylbenzene (CID 10081748) is 1-bromo-2,4-difluoro-5-methylbenzene.
What is the SMILES notation for 1-bromo-2,4-difluoro-5-methylbenzene?
The canonical SMILES for 1-bromo-2,4-difluoro-5-methylbenzene is Cc1cc(Br)c(F)cc1F.
What is the InChIKey of 1-bromo-2,4-difluoro-5-methylbenzene?
The InChIKey is WOCZKGUFVNUBEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrF2/c1-4-2-5(8)7(10)3-6(4)9/h2-3H,1H3.
What are the key properties of 1-bromo-2,4-difluoro-5-methylbenzene?
1-bromo-2,4-difluoro-5-methylbenzene has a molecular weight of 207.02 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,4-difluoro-5-methylbenzene is sourced from PubChem (CID 10081748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).