About 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one
4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one (PubChem CID 10081749) has the molecular formula C8H8Cl2O2
and a molecular weight of 207.06 g/mol. Its IUPAC name is 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one.
Molecular Properties
| Compound Name | 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one |
| PubChem CID | 10081749 |
| Molecular Formula | C8H8Cl2O2 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one |
| SMILES | C=CC(C)C1(O)C(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C8H8Cl2O2/c1-3-4(2)8(12)6(10)5(9)7(8)11/h3-4,12H,1H2,2H3 |
| InChIKey | YAYKEHYNTRLWAL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one?
The IUPAC name of 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one (CID 10081749) is 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one.
What is the SMILES notation for 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one?
The canonical SMILES for 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one is C=CC(C)C1(O)C(=O)C(Cl)=C1Cl.
What is the InChIKey of 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one?
The InChIKey is YAYKEHYNTRLWAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2O2/c1-3-4(2)8(12)6(10)5(9)7(8)11/h3-4,12H,1H2,2H3.
What are the key properties of 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one?
4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one has a molecular weight of 207.06 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-en-2-yl-2,3-dichloro-4-hydroxycyclobut-2-en-1-one is sourced from PubChem (CID 10081749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).