About (3,5-dimethoxyphenyl)methyl acetate
(3,5-dimethoxyphenyl)methyl acetate (PubChem CID 10081835) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)methyl acetate.
Molecular Properties
| Compound Name | (3,5-dimethoxyphenyl)methyl acetate |
| PubChem CID | 10081835 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (3,5-dimethoxyphenyl)methyl acetate |
| SMILES | COc1cc(COC(C)=O)cc(OC)c1 |
| InChI | InChI=1S/C11H14O4/c1-8(12)15-7-9-4-10(13-2)6-11(5-9)14-3/h4-6H,7H2,1-3H3 |
| InChIKey | KIRXKGAPUVUMBS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,5-dimethoxyphenyl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethoxyphenyl)methyl acetate?
The IUPAC name of (3,5-dimethoxyphenyl)methyl acetate (CID 10081835) is (3,5-dimethoxyphenyl)methyl acetate.
What is the SMILES notation for (3,5-dimethoxyphenyl)methyl acetate?
The canonical SMILES for (3,5-dimethoxyphenyl)methyl acetate is COc1cc(COC(C)=O)cc(OC)c1.
What is the InChIKey of (3,5-dimethoxyphenyl)methyl acetate?
The InChIKey is KIRXKGAPUVUMBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-8(12)15-7-9-4-10(13-2)6-11(5-9)14-3/h4-6H,7H2,1-3H3.
What are the key properties of (3,5-dimethoxyphenyl)methyl acetate?
(3,5-dimethoxyphenyl)methyl acetate has a molecular weight of 210.23 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethoxyphenyl)methyl acetate is sourced from PubChem (CID 10081835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).