About 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide
2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide (PubChem CID 100818351) has the molecular formula C16H26BrNO2
and a molecular weight of 344.29 g/mol. Its IUPAC name is 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide |
| PubChem CID | 100818351 |
| Molecular Formula | C16H26BrNO2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide |
| SMILES | COC[C@@H](C)NC(=O)CC12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C16H26BrNO2/c1-11(9-20-2)18-14(19)8-15-4-12-3-13(5-15)7-16(17,6-12)10-15/h11-13H,3-10H2,1-2H3,(H,18,19)/t11-,12-,13-,15?,16?/m1/s1 |
| InChIKey | RLRTVSXDBGBDNP-YYVONYOCSA-N |
| XLogP | 3.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide?
The IUPAC name of 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide (CID 100818351) is 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide.
What is the SMILES notation for 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide?
The canonical SMILES for 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide is COC[C@@H](C)NC(=O)CC12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2.
What is the InChIKey of 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide?
The InChIKey is RLRTVSXDBGBDNP-YYVONYOCSA-N. The full InChI is InChI=1S/C16H26BrNO2/c1-11(9-20-2)18-14(19)8-15-4-12-3-13(5-15)7-16(17,6-12)10-15/h11-13H,3-10H2,1-2H3,(H,18,19)/t11-,12-,13-,15?,16?/m1/s1.
What are the key properties of 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide?
2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide has a molecular weight of 344.29 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(2R)-1-methoxypropan-2-yl]acetamide is sourced from PubChem (CID 100818351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).