C15H17ClN4OS — CID 100818865
S-(4,6,7,8,9,10-hexahydro-[1,2,4]triazino[4,3-a]azepin-3-yl) N-(4-chlorophenyl)carbamothioate (PubChem CID 100818865) has the molecular formula C15H17ClN4OS and a molecular weight of 336.85 g/mol. Its IUPAC name is S-(4,6,7,8,9,10-hexahydro-[1,2,4]triazino[4,3-a]azepin-3-yl) N-(4-chlorophenyl)carbamothioate.
| Compound Name | S-(4,6,7,8,9,10-hexahydro-[1,2,4]triazino[4,3-a]azepin-3-yl) N-(4-chlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 100818865 |
| Molecular Formula | C15H17ClN4OS |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | S-(4,6,7,8,9,10-hexahydro-[1,2,4]triazino[4,3-a]azepin-3-yl) N-(4-chlorophenyl)carbamothioate |
| SMILES | O=C(Nc1ccc(Cl)cc1)SC1=NN=C2CCCCCN2C1 |
| InChI | InChI=1S/C15H17ClN4OS/c16-11-5-7-12(8-6-11)17-15(21)22-14-10-20-9-3-1-2-4-13(20)18-19-14/h5-8H,1-4,9-10H2,(H,17,21) |
| InChIKey | RLJDHYHTBGGTGK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|