C17H15N3 — CID 100818883
N-methyl-11,13-dihydroisoindolo[2,1-b][2,4]benzodiazepin-6-imine (PubChem CID 100818883) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is N-methyl-11,13-dihydroisoindolo[2,1-b][2,4]benzodiazepin-6-imine.
| Compound Name | N-methyl-11,13-dihydroisoindolo[2,1-b][2,4]benzodiazepin-6-imine |
|---|---|
| PubChem CID | 100818883 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-methyl-11,13-dihydroisoindolo[2,1-b][2,4]benzodiazepin-6-imine |
| SMILES | C/N=C1\N=C2c3ccccc3CN2Cc2ccccc21 |
| InChI | InChI=1S/C17H15N3/c1-18-16-14-8-4-2-6-12(14)10-20-11-13-7-3-5-9-15(13)17(20)19-16/h2-9H,10-11H2,1H3/b18-16- |
| InChIKey | MJWMUFVZNHKNJL-VLGSPTGOSA-N |
| XLogP | 2.84 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|