C11H16O4 — CID 10081899
(3S,3aS,6R,6aR)-6-butyl-3-methyl-3,3a,6,6a-tetrahydrofuro[2,3-c]furan-2,4-dione (PubChem CID 10081899) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3S,3aS,6R,6aR)-6-butyl-3-methyl-3,3a,6,6a-tetrahydrofuro[2,3-c]furan-2,4-dione.
| Compound Name | (3S,3aS,6R,6aR)-6-butyl-3-methyl-3,3a,6,6a-tetrahydrofuro[2,3-c]furan-2,4-dione |
|---|---|
| PubChem CID | 10081899 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3S,3aS,6R,6aR)-6-butyl-3-methyl-3,3a,6,6a-tetrahydrofuro[2,3-c]furan-2,4-dione |
| SMILES | CCCC[C@H]1OC(=O)[C@@H]2[C@H]1OC(=O)[C@H]2C |
| InChI | InChI=1S/C11H16O4/c1-3-4-5-7-9-8(11(13)14-7)6(2)10(12)15-9/h6-9H,3-5H2,1-2H3/t6-,7+,8-,9-/m0/s1 |
| InChIKey | AKGDZWRMFDLKFE-KZVJFYERSA-N |
| XLogP | 1.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |