C12H6Cl6O3 — CID 100819182
(1R,2S,6S,7R)-4-acetyl-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 100819182) has the molecular formula C12H6Cl6O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-acetyl-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-4-acetyl-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 100819182 |
| Molecular Formula | C12H6Cl6O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 407.84 |
| IUPAC Name | (1R,2S,6S,7R)-4-acetyl-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC(=O)C1C(=O)[C@@H]2[C@@H](C1=O)[C@@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C12H6Cl6O3/c1-2(19)3-6(20)4-5(7(3)21)11(16)9(14)8(13)10(4,15)12(11,17)18/h3-5H,1H3/t4-,5-,10+,11+/m0/s1 |
| InChIKey | XNWBXIRIABZIIO-XGMKGGNISA-N |
| XLogP | 3.42 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|