About (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate
(5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate (PubChem CID 10081936) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate |
| PubChem CID | 10081936 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate |
| SMILES | CNC(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C12H23NO2/c1-8(2)10-6-5-9(3)7-11(10)15-12(14)13-4/h8-11H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | MFECVIRCZJLBCY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate (CID 10081936) is (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate is CNC(=O)OC1CC(C)CCC1C(C)C.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate?
The InChIKey is MFECVIRCZJLBCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-8(2)10-6-5-9(3)7-11(10)15-12(14)13-4/h8-11H,5-7H2,1-4H3,(H,13,14).
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate?
(5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate has a molecular weight of 213.32 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) N-methylcarbamate is sourced from PubChem (CID 10081936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).