About (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol
(1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol (PubChem CID 10081975) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol.
Molecular Properties
| Compound Name | (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol |
| PubChem CID | 10081975 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol |
| SMILES | CC(C)NC[C@H](O)[C@H]1CC(C(C)C)=NO1 |
| InChI | InChI=1S/C11H22N2O2/c1-7(2)9-5-11(15-13-9)10(14)6-12-8(3)4/h7-8,10-12,14H,5-6H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | ODJKFICHRVPSGA-WDEREUQCSA-N |
| XLogP | 1.15 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol?
The IUPAC name of (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol (CID 10081975) is (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol.
What is the SMILES notation for (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol?
The canonical SMILES for (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol is CC(C)NC[C@H](O)[C@H]1CC(C(C)C)=NO1.
What is the InChIKey of (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol?
The InChIKey is ODJKFICHRVPSGA-WDEREUQCSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-7(2)9-5-11(15-13-9)10(14)6-12-8(3)4/h7-8,10-12,14H,5-6H2,1-4H3/t10-,11+/m0/s1.
What are the key properties of (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol?
(1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol has a molecular weight of 214.31 g/mol, XLogP of 1.15, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-(propan-2-ylamino)-1-[(5R)-3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol is sourced from PubChem (CID 10081975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).