C9H13NO5 — CID 10081988
[(1R,2R,3S)-3-formyl-2-nitrocyclohexyl] acetate (PubChem CID 10081988) has the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. Its IUPAC name is [(1R,2R,3S)-3-formyl-2-nitrocyclohexyl] acetate.
| Compound Name | [(1R,2R,3S)-3-formyl-2-nitrocyclohexyl] acetate |
|---|---|
| PubChem CID | 10081988 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | [(1R,2R,3S)-3-formyl-2-nitrocyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC[C@H](C=O)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13NO5/c1-6(12)15-8-4-2-3-7(5-11)9(8)10(13)14/h5,7-9H,2-4H2,1H3/t7-,8-,9-/m1/s1 |
| InChIKey | ZOEWADGWQOWXJI-IWSPIJDZSA-N |
| XLogP | 0.56 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|