C17H21N3O2 — CID 100819889
2-(4-methyl-1-phenylpyrazol-3-yl)oxy-1-piperidin-1-ylethanone (PubChem CID 100819889) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-(4-methyl-1-phenylpyrazol-3-yl)oxy-1-piperidin-1-ylethanone.
| Compound Name | 2-(4-methyl-1-phenylpyrazol-3-yl)oxy-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 100819889 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-(4-methyl-1-phenylpyrazol-3-yl)oxy-1-piperidin-1-ylethanone |
| SMILES | Cc1cn(-c2ccccc2)nc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H21N3O2/c1-14-12-20(15-8-4-2-5-9-15)18-17(14)22-13-16(21)19-10-6-3-7-11-19/h2,4-5,8-9,12H,3,6-7,10-11,13H2,1H3 |
| InChIKey | LVVVZMKGPGIFJV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |