C18H29NO4S — CID 100820311
5-(decylsulfamoyl)-2-methylbenzoic acid (PubChem CID 100820311) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is 5-(decylsulfamoyl)-2-methylbenzoic acid.
| Compound Name | 5-(decylsulfamoyl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 100820311 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 5-(decylsulfamoyl)-2-methylbenzoic acid |
| SMILES | CCCCCCCCCCNS(=O)(=O)c1ccc(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H29NO4S/c1-3-4-5-6-7-8-9-10-13-19-24(22,23)16-12-11-15(2)17(14-16)18(20)21/h11-12,14,19H,3-10,13H2,1-2H3,(H,20,21) |
| InChIKey | XPBDUDWBTFPVFD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|