C20H21ClFNO4 — CID 100821643
pentyl (1R,5S,6R,7R)-3-(4-chloro-3-fluorophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 100821643) has the molecular formula C20H21ClFNO4 and a molecular weight of 393.84 g/mol. Its IUPAC name is pentyl (1R,5S,6R,7R)-3-(4-chloro-3-fluorophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | pentyl (1R,5S,6R,7R)-3-(4-chloro-3-fluorophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 100821643 |
| Molecular Formula | C20H21ClFNO4 |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | pentyl (1R,5S,6R,7R)-3-(4-chloro-3-fluorophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CCCCCOC(=O)[C@H]1[C@H]2C=C[C@@]3(CN(c4ccc(Cl)c(F)c4)C(=O)[C@@H]13)O2 |
| InChI | InChI=1S/C20H21ClFNO4/c1-2-3-4-9-26-19(25)16-15-7-8-20(27-15)11-23(18(24)17(16)20)12-5-6-13(21)14(22)10-12/h5-8,10,15-17H,2-4,9,11H2,1H3/t15-,16+,17-,20+/m1/s1 |
| InChIKey | GHVYVICBHNPNTD-YZLZLFLDSA-N |
| XLogP | 3.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|