C13H18O3 — CID 10082277
(3E,6E)-4,6-diethoxynona-1,3,6,8-tetraen-5-one (PubChem CID 10082277) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (3E,6E)-4,6-diethoxynona-1,3,6,8-tetraen-5-one.
| Compound Name | (3E,6E)-4,6-diethoxynona-1,3,6,8-tetraen-5-one |
|---|---|
| PubChem CID | 10082277 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3E,6E)-4,6-diethoxynona-1,3,6,8-tetraen-5-one |
| SMILES | C=C/C=C(/OCC)C(=O)/C(=C\C=C)OCC |
| InChI | InChI=1S/C13H18O3/c1-5-9-11(15-7-3)13(14)12(10-6-2)16-8-4/h5-6,9-10H,1-2,7-8H2,3-4H3/b11-9+,12-10+ |
| InChIKey | OSGFBUUXVWGXQM-WGDLNXRISA-N |
| XLogP | 2.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|