C21H27Cl2N5O2 — CID 100823179
7-[[(1S,6S)-2,6-dichlorocyclohexa-2,4-dien-1-yl]methyl]-1,3-dimethyl-8-[[(3R)-3-methylpiperidin-1-yl]methyl]purine-2,6-dione (PubChem CID 100823179) has the molecular formula C21H27Cl2N5O2 and a molecular weight of 452.39 g/mol. Its IUPAC name is 7-[[(1S,6S)-2,6-dichlorocyclohexa-2,4-dien-1-yl]methyl]-1,3-dimethyl-8-[[(3R)-3-methylpiperidin-1-yl]methyl]purine-2,6-dione.
| Compound Name | 7-[[(1S,6S)-2,6-dichlorocyclohexa-2,4-dien-1-yl]methyl]-1,3-dimethyl-8-[[(3R)-3-methylpiperidin-1-yl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 100823179 |
| Molecular Formula | C21H27Cl2N5O2 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 7-[[(1S,6S)-2,6-dichlorocyclohexa-2,4-dien-1-yl]methyl]-1,3-dimethyl-8-[[(3R)-3-methylpiperidin-1-yl]methyl]purine-2,6-dione |
| SMILES | C[C@@H]1CCCN(Cc2nc3c(c(=O)n(C)c(=O)n3C)n2C[C@@H]2C(Cl)=CC=C[C@@H]2Cl)C1 |
| InChI | InChI=1S/C21H27Cl2N5O2/c1-13-6-5-9-27(10-13)12-17-24-19-18(20(29)26(3)21(30)25(19)2)28(17)11-14-15(22)7-4-8-16(14)23/h4,7-8,13-15H,5-6,9-12H2,1-3H3/t13-,14+,15+/m1/s1 |
| InChIKey | AOJXNFQYCOYFCH-ILXRZTDVSA-N |
| XLogP | 2.58 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|