C24H23N3O4S2 — CID 100823418
[(3S)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate (PubChem CID 100823418) has the molecular formula C24H23N3O4S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is [(3S)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate.
| Compound Name | [(3S)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate |
|---|---|
| PubChem CID | 100823418 |
| Molecular Formula | C24H23N3O4S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | [(3S)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate |
| SMILES | C[C@@H]1CN(C(=S)S[C@H]2CC(=O)N(c3ccc(-c4nc5ccccc5o4)cc3)C2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C24H23N3O4S2/c1-14-12-26(13-15(2)30-14)24(32)33-20-11-21(28)27(23(20)29)17-9-7-16(8-10-17)22-25-18-5-3-4-6-19(18)31-22/h3-10,14-15,20H,11-13H2,1-2H3/t14-,15+,20-/m0/s1 |
| InChIKey | HZAAQWDIMMTFEO-MDOVXXIYSA-N |
| XLogP | 4.25 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|