C12H19NO3 — CID 10082381
(NE)-N-[(4aR,8aS)-spiro[1,3,4,4a,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-2-ylidene]hydroxylamine (PubChem CID 10082381) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (NE)-N-[(4aR,8aS)-spiro[1,3,4,4a,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4aR,8aS)-spiro[1,3,4,4a,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 10082381 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (NE)-N-[(4aR,8aS)-spiro[1,3,4,4a,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-2-ylidene]hydroxylamine |
| SMILES | O/N=C1\CC[C@@H]2CC3(CC[C@H]2C1)OCCO3 |
| InChI | InChI=1S/C12H19NO3/c14-13-11-2-1-10-8-12(15-5-6-16-12)4-3-9(10)7-11/h9-10,14H,1-8H2/b13-11+/t9-,10+/m0/s1 |
| InChIKey | IWNWVJIZKUXKTH-ASGAHOKESA-N |
| XLogP | 2.16 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|