C34H23Cl2NO3 — CID 100824403
(1R,2S,3aS)-1-benzoyl-2-(2,4-dichlorophenyl)-8-methylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 100824403) has the molecular formula C34H23Cl2NO3 and a molecular weight of 564.47 g/mol. Its IUPAC name is (1R,2S,3aS)-1-benzoyl-2-(2,4-dichlorophenyl)-8-methylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1R,2S,3aS)-1-benzoyl-2-(2,4-dichlorophenyl)-8-methylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 100824403 |
| Molecular Formula | C34H23Cl2NO3 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | (1R,2S,3aS)-1-benzoyl-2-(2,4-dichlorophenyl)-8-methylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | Cc1ccc2c(c1)N1[C@@H](C=C2)C2(C(=O)c3ccccc3C2=O)[C@@H](c2ccc(Cl)cc2Cl)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C34H23Cl2NO3/c1-19-11-12-20-13-16-28-34(32(39)23-9-5-6-10-24(23)33(34)40)29(25-15-14-22(35)18-26(25)36)30(37(28)27(20)17-19)31(38)21-7-3-2-4-8-21/h2-18,28-30H,1H3/t28-,29-,30+/m0/s1 |
| InChIKey | TUAFMTOXWOQTQN-OIFRRMEBSA-N |
| XLogP | 7.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|