C14H18N2O5S — CID 100830352
4-ethyl-6-morpholin-4-ylsulfonyl-1,4-benzoxazin-3-one (PubChem CID 100830352) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 4-ethyl-6-morpholin-4-ylsulfonyl-1,4-benzoxazin-3-one.
| Compound Name | 4-ethyl-6-morpholin-4-ylsulfonyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 100830352 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-ethyl-6-morpholin-4-ylsulfonyl-1,4-benzoxazin-3-one |
| SMILES | CCN1C(=O)COc2ccc(S(=O)(=O)N3CCOCC3)cc21 |
| InChI | InChI=1S/C14H18N2O5S/c1-2-16-12-9-11(3-4-13(12)21-10-14(16)17)22(18,19)15-5-7-20-8-6-15/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | GAQBDBICLPVSDG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |