C13H18LiNO3 — CID 10083125
lithium N-(4,5-dimethoxycyclohexa-2,4-dien-1-ylidene)-2,2-dimethylpropanamide (PubChem CID 10083125) has the molecular formula C13H18LiNO3 and a molecular weight of 243.23 g/mol. Its IUPAC name is lithium N-(4,5-dimethoxycyclohexa-2,4-dien-1-ylidene)-2,2-dimethylpropanamide.
| Compound Name | lithium N-(4,5-dimethoxycyclohexa-2,4-dien-1-ylidene)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 10083125 |
| Molecular Formula | C13H18LiNO3 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | lithium N-(4,5-dimethoxycyclohexa-2,4-dien-1-ylidene)-2,2-dimethylpropanamide |
| SMILES | COc1cc/c(=N\C(=O)C(C)(C)C)[cH-]c1OC.[Li+] |
| InChI | InChI=1S/C13H18NO3.Li/c1-13(2,3)12(15)14-9-6-7-10(16-4)11(8-9)17-5;/h6-8H,1-5H3;/q-1;+1/b14-9+; |
| InChIKey | ULEUJONBWYAJMU-KYIGKLDSSA-N |
| XLogP | -1.10 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|