About N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide
N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide (PubChem CID 100831386) has the molecular formula C12H9NO4
and a molecular weight of 231.21 g/mol. Its IUPAC name is N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide |
| PubChem CID | 100831386 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC1(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H9NO4/c1-2-9(14)13-12(17)10(15)7-5-3-4-6-8(7)11(12)16/h2-6,17H,1H2,(H,13,14) |
| InChIKey | AYIDDAQOFIGTQG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide?
The IUPAC name of N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide (CID 100831386) is N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide.
What is the SMILES notation for N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide?
The canonical SMILES for N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide is C=CC(=O)NC1(O)C(=O)c2ccccc2C1=O.
What is the InChIKey of N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide?
The InChIKey is AYIDDAQOFIGTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO4/c1-2-9(14)13-12(17)10(15)7-5-3-4-6-8(7)11(12)16/h2-6,17H,1H2,(H,13,14).
What are the key properties of N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide?
N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide has a molecular weight of 231.21 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-1,3-dioxoinden-2-yl)prop-2-enamide is sourced from PubChem (CID 100831386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).