C13H25NO3 — CID 10083148
(2R,4S,5S)-5-amino-6-cyclohexyl-4-hydroxy-2-methylhexanoic acid (PubChem CID 10083148) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (2R,4S,5S)-5-amino-6-cyclohexyl-4-hydroxy-2-methylhexanoic acid.
| Compound Name | (2R,4S,5S)-5-amino-6-cyclohexyl-4-hydroxy-2-methylhexanoic acid |
|---|---|
| PubChem CID | 10083148 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (2R,4S,5S)-5-amino-6-cyclohexyl-4-hydroxy-2-methylhexanoic acid |
| SMILES | C[C@H](C[C@H](O)[C@@H](N)CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C13H25NO3/c1-9(13(16)17)7-12(15)11(14)8-10-5-3-2-4-6-10/h9-12,15H,2-8,14H2,1H3,(H,16,17)/t9-,11+,12+/m1/s1 |
| InChIKey | IMFGHYPPYDZMGL-USWWRNFRSA-N |
| XLogP | 1.76 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |