C15H20OS — CID 10083375
(3R,3aR)-3-(phenylsulfanylmethyl)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-ol (PubChem CID 10083375) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is (3R,3aR)-3-(phenylsulfanylmethyl)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-ol.
| Compound Name | (3R,3aR)-3-(phenylsulfanylmethyl)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-ol |
|---|---|
| PubChem CID | 10083375 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (3R,3aR)-3-(phenylsulfanylmethyl)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-ol |
| SMILES | O[C@]12CCCC1CC[C@H]2CSc1ccccc1 |
| InChI | InChI=1S/C15H20OS/c16-15-10-4-5-12(15)8-9-13(15)11-17-14-6-2-1-3-7-14/h1-3,6-7,12-13,16H,4-5,8-11H2/t12?,13-,15+/m0/s1 |
| InChIKey | JWHCOCDVBNFXSA-RGPPAHDHSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |