About [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol
[(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol (PubChem CID 10083414) has the molecular formula C15H20FNO
and a molecular weight of 249.33 g/mol. Its IUPAC name is [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol.
Molecular Properties
| Compound Name | [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol |
| PubChem CID | 10083414 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol |
| SMILES | CN1C2CC[C@@H]1[C@H](CO)[C@@H](c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C15H20FNO/c1-17-12-6-7-15(17)14(9-18)13(8-12)10-2-4-11(16)5-3-10/h2-5,12-15,18H,6-9H2,1H3/t12?,13-,14-,15-/m1/s1 |
| InChIKey | CZRLQYHGYBWJCU-KBUZWXASSA-N |
| XLogP | 2.38 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol?
The IUPAC name of [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol (CID 10083414) is [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol.
What is the SMILES notation for [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol?
The canonical SMILES for [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol is CN1C2CC[C@@H]1[C@H](CO)[C@@H](c1ccc(F)cc1)C2.
What is the InChIKey of [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol?
The InChIKey is CZRLQYHGYBWJCU-KBUZWXASSA-N. The full InChI is InChI=1S/C15H20FNO/c1-17-12-6-7-15(17)14(9-18)13(8-12)10-2-4-11(16)5-3-10/h2-5,12-15,18H,6-9H2,1H3/t12?,13-,14-,15-/m1/s1.
What are the key properties of [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol?
[(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol has a molecular weight of 249.33 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methanol is sourced from PubChem (CID 10083414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).