C33H20Cl4N2O4 — CID 100834366
(2S,6S,7R,11S)-15-chloro-4,9-bis(4-chlorophenyl)-6-[(4-chlorophenyl)methyl]-4,9-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-3,5,8,10-tetrone (PubChem CID 100834366) has the molecular formula C33H20Cl4N2O4 and a molecular weight of 650.35 g/mol. Its IUPAC name is (2S,6S,7R,11S)-15-chloro-4,9-bis(4-chlorophenyl)-6-[(4-chlorophenyl)methyl]-4,9-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-3,5,8,10-tetrone.
| Compound Name | (2S,6S,7R,11S)-15-chloro-4,9-bis(4-chlorophenyl)-6-[(4-chlorophenyl)methyl]-4,9-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 100834366 |
| Molecular Formula | C33H20Cl4N2O4 |
| Molecular Weight | 650.35 g/mol |
| Exact Mass | 648.02 |
| IUPAC Name | (2S,6S,7R,11S)-15-chloro-4,9-bis(4-chlorophenyl)-6-[(4-chlorophenyl)methyl]-4,9-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-3,5,8,10-tetrone |
| SMILES | O=C1[C@@H]2c3ccc(Cl)cc3[C@@H]3C(=O)N(c4ccc(Cl)cc4)C(=O)[C@@]3(Cc3ccc(Cl)cc3)[C@@H]2C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H20Cl4N2O4/c34-18-3-1-17(2-4-18)16-33-27(30(41)39(32(33)43)23-12-7-20(36)8-13-23)25-15-21(37)9-14-24(25)26-28(33)31(42)38(29(26)40)22-10-5-19(35)6-11-22/h1-15,26-28H,16H2/t26-,27-,28+,33-/m1/s1 |
| InChIKey | WUGVNCNVTJFIDD-LUYUGSQRSA-N |
| XLogP | 7.47 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.35 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|