C15H22O3 — CID 10083471
(3R,5R,8S)-3,8-dihydroxy-3,8-dimethyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-2H-azulen-1-one (PubChem CID 10083471) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3R,5R,8S)-3,8-dihydroxy-3,8-dimethyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-2H-azulen-1-one.
| Compound Name | (3R,5R,8S)-3,8-dihydroxy-3,8-dimethyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-2H-azulen-1-one |
|---|---|
| PubChem CID | 10083471 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3R,5R,8S)-3,8-dihydroxy-3,8-dimethyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-2H-azulen-1-one |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(O)C2=C(C1)[C@](C)(O)CC2=O |
| InChI | InChI=1S/C15H22O3/c1-9(2)10-5-6-14(3,17)13-11(7-10)15(4,18)8-12(13)16/h10,17-18H,1,5-8H2,2-4H3/t10-,14+,15-/m1/s1 |
| InChIKey | QPSIPXFEOVTZFP-WKPIXPDZSA-N |
| XLogP | 2.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|