About 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline
3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline (PubChem CID 10083699) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline.
Molecular Properties
| Compound Name | 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline |
| PubChem CID | 10083699 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline |
| SMILES | COc1cc2cc(C3=CCCC3)cnc2cc1OC |
| InChI | InChI=1S/C16H17NO2/c1-18-15-8-12-7-13(11-5-3-4-6-11)10-17-14(12)9-16(15)19-2/h5,7-10H,3-4,6H2,1-2H3 |
| InChIKey | DVMMSUYWABLYCR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline?
The IUPAC name of 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline (CID 10083699) is 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline.
What is the SMILES notation for 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline?
The canonical SMILES for 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline is COc1cc2cc(C3=CCCC3)cnc2cc1OC.
What is the InChIKey of 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline?
The InChIKey is DVMMSUYWABLYCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c1-18-15-8-12-7-13(11-5-3-4-6-11)10-17-14(12)9-16(15)19-2/h5,7-10H,3-4,6H2,1-2H3.
What are the key properties of 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline?
3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline has a molecular weight of 255.32 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopenten-1-yl)-6,7-dimethoxyquinoline is sourced from PubChem (CID 10083699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).